C35H24F4N4O3S — CID 19312497
N-[(Z)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19312497) has the molecular formula C35H24F4N4O3S and a molecular weight of 656.66 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312497 |
| Molecular Formula | C35H24F4N4O3S |
| Molecular Weight | 656.66 g/mol |
| Exact Mass | 656.15 |
| IUPAC Name | N-[(Z)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2c(F)c(F)cc(F)c2F)c2ccccc2)c1)/C(=C/c1cccnc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H24F4N4O3S/c36-26-19-27(37)30(39)31(29(26)38)43-35(46)32(22-10-3-1-4-11-22)47-25-15-7-14-24(18-25)41-34(45)28(17-21-9-8-16-40-20-21)42-33(44)23-12-5-2-6-13-23/h1-20,32H,(H,41,45)(H,42,44)(H,43,46)/b28-17- |
| InChIKey | ILOFRIAHDLJDHB-QRQIAZFYSA-N |
| XLogP | 7.52 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.66 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|