C36H30N4O4S — CID 19312475
N-[(Z)-3-[3-[2-(2-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19312475) has the molecular formula C36H30N4O4S and a molecular weight of 614.73 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(2-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(2-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312475 |
| Molecular Formula | C36H30N4O4S |
| Molecular Weight | 614.73 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | N-[(Z)-3-[3-[2-(2-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | COc1ccccc1NC(=O)C(Sc1cccc(NC(=O)/C(=C/c2cccnc2)NC(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C36H30N4O4S/c1-44-32-20-9-8-19-30(32)39-36(43)33(26-13-4-2-5-14-26)45-29-18-10-17-28(23-29)38-35(42)31(22-25-12-11-21-37-24-25)40-34(41)27-15-6-3-7-16-27/h2-24,33H,1H3,(H,38,42)(H,39,43)(H,40,41)/b31-22- |
| InChIKey | OHNREUVBTGXECV-VAMRJTSQSA-N |
| XLogP | 6.97 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.73 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|