C35H27FN4O3S — CID 22189108
N-[(Z)-3-[4-[2-(2-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22189108) has the molecular formula C35H27FN4O3S and a molecular weight of 602.69 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(2-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(2-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22189108 |
| Molecular Formula | C35H27FN4O3S |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | N-[(Z)-3-[4-[2-(2-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccccc2F)c2ccccc2)cc1)/C(=C/c1cccnc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H27FN4O3S/c36-29-15-7-8-16-30(29)39-35(43)32(25-11-3-1-4-12-25)44-28-19-17-27(18-20-28)38-34(42)31(22-24-10-9-21-37-23-24)40-33(41)26-13-5-2-6-14-26/h1-23,32H,(H,38,42)(H,39,43)(H,40,41)/b31-22- |
| InChIKey | MZESHLRXDHGCHU-VAMRJTSQSA-N |
| XLogP | 7.10 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|