C37H28F3N3O3S — CID 19304949
N-[(Z)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 19304949) has the molecular formula C37H28F3N3O3S and a molecular weight of 651.71 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19304949 |
| Molecular Formula | C37H28F3N3O3S |
| Molecular Weight | 651.71 g/mol |
| Exact Mass | 651.18 |
| IUPAC Name | N-[(Z)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2cccc(C(F)(F)F)c2)c2ccccc2)c1)/C(=C/c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H28F3N3O3S/c38-37(39,40)28-18-10-19-29(23-28)42-36(46)33(26-14-6-2-7-15-26)47-31-21-11-20-30(24-31)41-35(45)32(22-25-12-4-1-5-13-25)43-34(44)27-16-8-3-9-17-27/h1-24,33H,(H,41,45)(H,42,46)(H,43,44)/b32-22- |
| InChIKey | NCAGIXXAPSVMMB-JDCMOKTRSA-N |
| XLogP | 8.59 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.71 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|