C37H27BrF3N3O3S — CID 22191166
N-[(Z)-1-(4-bromophenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22191166) has the molecular formula C37H27BrF3N3O3S and a molecular weight of 730.61 g/mol. Its IUPAC name is N-[(Z)-1-(4-bromophenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-bromophenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22191166 |
| Molecular Formula | C37H27BrF3N3O3S |
| Molecular Weight | 730.61 g/mol |
| Exact Mass | 729.09 |
| IUPAC Name | N-[(Z)-1-(4-bromophenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2cccc(C(F)(F)F)c2)c2ccccc2)cc1)/C(=C/c1ccc(Br)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H27BrF3N3O3S/c38-28-16-14-24(15-17-28)22-32(44-34(45)26-10-5-2-6-11-26)35(46)42-29-18-20-31(21-19-29)48-33(25-8-3-1-4-9-25)36(47)43-30-13-7-12-27(23-30)37(39,40)41/h1-23,33H,(H,42,46)(H,43,47)(H,44,45)/b32-22- |
| InChIKey | NAOOMJWRJNVVOY-JDCMOKTRSA-N |
| XLogP | 9.35 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.61 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|