C37H30ClN3O3S — CID 19304958
N-[(Z)-3-[3-[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 19304958) has the molecular formula C37H30ClN3O3S and a molecular weight of 632.19 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19304958 |
| Molecular Formula | C37H30ClN3O3S |
| Molecular Weight | 632.19 g/mol |
| Exact Mass | 631.17 |
| IUPAC Name | N-[(Z)-3-[3-[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(NC(=O)C(Sc2cccc(NC(=O)/C(=C/c3ccccc3)NC(=O)c3ccccc3)c2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C37H30ClN3O3S/c1-25-20-21-30(24-32(25)38)40-37(44)34(27-14-7-3-8-15-27)45-31-19-11-18-29(23-31)39-36(43)33(22-26-12-5-2-6-13-26)41-35(42)28-16-9-4-10-17-28/h2-24,34H,1H3,(H,39,43)(H,40,44)(H,41,42)/b33-22- |
| InChIKey | RJVDJDMJOOJEHN-NVMPUMLXSA-N |
| XLogP | 8.53 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.19 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|