C38H30ClN3O5S — CID 19305877
3-[[2-[3-[[(Z)-2-benzamido-3-(3-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-methylbenzoic acid (PubChem CID 19305877) has the molecular formula C38H30ClN3O5S and a molecular weight of 676.19 g/mol. Its IUPAC name is 3-[[2-[3-[[(Z)-2-benzamido-3-(3-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-methylbenzoic acid.
| Compound Name | 3-[[2-[3-[[(Z)-2-benzamido-3-(3-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 19305877 |
| Molecular Formula | C38H30ClN3O5S |
| Molecular Weight | 676.19 g/mol |
| Exact Mass | 675.16 |
| IUPAC Name | 3-[[2-[3-[[(Z)-2-benzamido-3-(3-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)C(Sc1cccc(NC(=O)/C(=C/c2cccc(Cl)c2)NC(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C38H30ClN3O5S/c1-24-18-19-28(38(46)47)22-32(24)41-37(45)34(26-11-4-2-5-12-26)48-31-17-9-16-30(23-31)40-36(44)33(21-25-10-8-15-29(39)20-25)42-35(43)27-13-6-3-7-14-27/h2-23,34H,1H3,(H,40,44)(H,41,45)(H,42,43)(H,46,47)/b33-21- |
| InChIKey | BEGKLBDGWYDEFC-HWIUFGAZSA-N |
| XLogP | 8.23 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.19 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|