C40H34ClN3O5S — CID 19311338
3-[[2-[3-[[(E)-2-benzamido-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-chlorobenzoic acid (PubChem CID 19311338) has the molecular formula C40H34ClN3O5S and a molecular weight of 704.25 g/mol. Its IUPAC name is 3-[[2-[3-[[(E)-2-benzamido-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-chlorobenzoic acid.
| Compound Name | 3-[[2-[3-[[(E)-2-benzamido-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 19311338 |
| Molecular Formula | C40H34ClN3O5S |
| Molecular Weight | 704.25 g/mol |
| Exact Mass | 703.19 |
| IUPAC Name | 3-[[2-[3-[[(E)-2-benzamido-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-chlorobenzoic acid |
| SMILES | CC(C)c1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3cc(C(=O)O)ccc3Cl)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C40H34ClN3O5S/c1-25(2)27-18-16-26(17-19-27)22-35(44-37(45)29-12-7-4-8-13-29)38(46)42-31-14-9-15-32(24-31)50-36(28-10-5-3-6-11-28)39(47)43-34-23-30(40(48)49)20-21-33(34)41/h3-25,36H,1-2H3,(H,42,46)(H,43,47)(H,44,45)(H,48,49)/b35-22+ |
| InChIKey | XMEZFOMUJNNIOJ-FADJLKOXSA-N |
| XLogP | 9.04 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.25 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|