C38H30ClN3O6S — CID 19309034
3-[[2-[3-[[(E)-2-benzamido-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-chlorobenzoic acid (PubChem CID 19309034) has the molecular formula C38H30ClN3O6S and a molecular weight of 692.19 g/mol. Its IUPAC name is 3-[[2-[3-[[(E)-2-benzamido-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-chlorobenzoic acid.
| Compound Name | 3-[[2-[3-[[(E)-2-benzamido-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 19309034 |
| Molecular Formula | C38H30ClN3O6S |
| Molecular Weight | 692.19 g/mol |
| Exact Mass | 691.15 |
| IUPAC Name | 3-[[2-[3-[[(E)-2-benzamido-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-chlorobenzoic acid |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3cc(C(=O)O)ccc3Cl)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C38H30ClN3O6S/c1-48-29-18-15-24(16-19-29)21-33(42-35(43)26-11-6-3-7-12-26)36(44)40-28-13-8-14-30(23-28)49-34(25-9-4-2-5-10-25)37(45)41-32-22-27(38(46)47)17-20-31(32)39/h2-23,34H,1H3,(H,40,44)(H,41,45)(H,42,43)(H,46,47)/b33-21+ |
| InChIKey | RLCKONUDUBDMHL-QNKGDIEWSA-N |
| XLogP | 7.93 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.19 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|