C39H33N3O6S — CID 19309045
3-[[2-[3-[[(E)-2-benzamido-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-methylbenzoic acid (PubChem CID 19309045) has the molecular formula C39H33N3O6S and a molecular weight of 671.78 g/mol. Its IUPAC name is 3-[[2-[3-[[(E)-2-benzamido-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-methylbenzoic acid.
| Compound Name | 3-[[2-[3-[[(E)-2-benzamido-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 19309045 |
| Molecular Formula | C39H33N3O6S |
| Molecular Weight | 671.78 g/mol |
| Exact Mass | 671.21 |
| IUPAC Name | 3-[[2-[3-[[(E)-2-benzamido-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-methylbenzoic acid |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3cc(C(=O)O)ccc3C)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C39H33N3O6S/c1-25-16-19-29(39(46)47)23-33(25)41-38(45)35(27-10-5-3-6-11-27)49-32-15-9-14-30(24-32)40-37(44)34(22-26-17-20-31(48-2)21-18-26)42-36(43)28-12-7-4-8-13-28/h3-24,35H,1-2H3,(H,40,44)(H,41,45)(H,42,43)(H,46,47)/b34-22+ |
| InChIKey | HUZMLEYEBOUHBI-PPOKSSTKSA-N |
| XLogP | 7.58 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.78 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|