C35H28ClN3O3S2 — CID 19312159
N-[(Z)-3-[3-[2-(5-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19312159) has the molecular formula C35H28ClN3O3S2 and a molecular weight of 638.21 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(5-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(5-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312159 |
| Molecular Formula | C35H28ClN3O3S2 |
| Molecular Weight | 638.21 g/mol |
| Exact Mass | 637.13 |
| IUPAC Name | N-[(Z)-3-[3-[2-(5-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(Sc1cccc(NC(=O)/C(=C/c2ccsc2)NC(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C35H28ClN3O3S2/c1-23-15-16-27(36)20-30(23)38-35(42)32(25-9-4-2-5-10-25)44-29-14-8-13-28(21-29)37-34(41)31(19-24-17-18-43-22-24)39-33(40)26-11-6-3-7-12-26/h2-22,32H,1H3,(H,37,41)(H,38,42)(H,39,40)/b31-19- |
| InChIKey | RBBMUXJIRNCZPI-DXJNIWACSA-N |
| XLogP | 8.59 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.21 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|