C34H28N2O2PS+ — CID 98404366
[(E)-3-anilino-2-benzamido-3-oxo-1-sulfanylprop-1-enyl]-triphenylphosphanium (PubChem CID 98404366) has the molecular formula C34H28N2O2PS+ and a molecular weight of 559.65 g/mol. Its IUPAC name is [(E)-3-anilino-2-benzamido-3-oxo-1-sulfanylprop-1-enyl]-triphenylphosphanium.
| Compound Name | [(E)-3-anilino-2-benzamido-3-oxo-1-sulfanylprop-1-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 98404366 |
| Molecular Formula | C34H28N2O2PS+ |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | [(E)-3-anilino-2-benzamido-3-oxo-1-sulfanylprop-1-enyl]-triphenylphosphanium |
| SMILES | O=C(Nc1ccccc1)/C(NC(=O)c1ccccc1)=C(\S)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H27N2O2PS/c37-32(26-16-6-1-7-17-26)36-31(33(38)35-27-18-8-2-9-19-27)34(40)39(28-20-10-3-11-21-28,29-22-12-4-13-23-29)30-24-14-5-15-25-30/h1-25H,(H2-,35,36,37,38,40)/p+1 |
| InChIKey | SGUIQZAGGDWXGU-UHFFFAOYSA-O |
| XLogP | 6.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|