C34H27NO2PS+ — CID 135459561
(3-benzamido-1-hydroxy-1-phenyl-3-sulfanylideneprop-1-en-2-yl)-triphenylphosphanium (PubChem CID 135459561) has the molecular formula C34H27NO2PS+ and a molecular weight of 544.64 g/mol. Its IUPAC name is (3-benzamido-1-hydroxy-1-phenyl-3-sulfanylideneprop-1-en-2-yl)-triphenylphosphanium.
| Compound Name | (3-benzamido-1-hydroxy-1-phenyl-3-sulfanylideneprop-1-en-2-yl)-triphenylphosphanium |
|---|---|
| PubChem CID | 135459561 |
| Molecular Formula | C34H27NO2PS+ |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | (3-benzamido-1-hydroxy-1-phenyl-3-sulfanylideneprop-1-en-2-yl)-triphenylphosphanium |
| SMILES | O=C(NC(=S)C(=C(O)c1ccccc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H26NO2PS/c36-31(26-16-6-1-7-17-26)32(34(39)35-33(37)27-18-8-2-9-19-27)38(28-20-10-3-11-21-28,29-22-12-4-13-23-29)30-24-14-5-15-25-30/h1-25H,(H-,35,36,37,39)/p+1 |
| InChIKey | DZJVCONTCQDFSK-UHFFFAOYSA-O |
| XLogP | 6.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|