C28H22ClNO3P+ — CID 45148539
[(E)-2-benzamido-2-carboxy-1-chloroethenyl]-triphenylphosphanium (PubChem CID 45148539) has the molecular formula C28H22ClNO3P+ and a molecular weight of 486.92 g/mol. Its IUPAC name is [(E)-2-benzamido-2-carboxy-1-chloroethenyl]-triphenylphosphanium.
| Compound Name | [(E)-2-benzamido-2-carboxy-1-chloroethenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 45148539 |
| Molecular Formula | C28H22ClNO3P+ |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | [(E)-2-benzamido-2-carboxy-1-chloroethenyl]-triphenylphosphanium |
| SMILES | O=C(O)/C(NC(=O)c1ccccc1)=C(\Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H21ClNO3P/c29-26(25(28(32)33)30-27(31)21-13-5-1-6-14-21)34(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H,(H-,30,31,32,33)/p+1/b26-25- |
| InChIKey | OQYABNUUDXZGCY-QPLCGJKRSA-O |
| XLogP | 4.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|