C35H30Cl2N2O6P+ — CID 126958881
[2-benzamido-1-chloro-3-(4-methylanilino)-3-oxoprop-1-enyl]-triphenylphosphanium;perchloric acid (PubChem CID 126958881) has the molecular formula C35H30Cl2N2O6P+ and a molecular weight of 676.51 g/mol. Its IUPAC name is [2-benzamido-1-chloro-3-(4-methylanilino)-3-oxoprop-1-enyl]-triphenylphosphanium;perchloric acid.
| Compound Name | [2-benzamido-1-chloro-3-(4-methylanilino)-3-oxoprop-1-enyl]-triphenylphosphanium;perchloric acid |
|---|---|
| PubChem CID | 126958881 |
| Molecular Formula | C35H30Cl2N2O6P+ |
| Molecular Weight | 676.51 g/mol |
| Exact Mass | 675.12 |
| IUPAC Name | [2-benzamido-1-chloro-3-(4-methylanilino)-3-oxoprop-1-enyl]-triphenylphosphanium;perchloric acid |
| SMILES | Cc1ccc(NC(=O)C(NC(=O)c2ccccc2)=C(Cl)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C35H28ClN2O2P.ClHO4/c1-26-22-24-28(25-23-26)37-35(40)32(38-34(39)27-14-6-2-7-15-27)33(36)41(29-16-8-3-9-17-29,30-18-10-4-11-19-30)31-20-12-5-13-21-31;2-1(3,4)5/h2-25H,1H3,(H-,37,38,39,40);(H,2,3,4,5)/p+1 |
| InChIKey | GHFCXGRJBNAHBD-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 147.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|