C36H31Cl2N2O6P — CID 45050736
[(E)-1-chloro-3-(3-methylanilino)-2-[(3-methylbenzoyl)amino]-3-oxoprop-1-enyl]-triphenylphosphanium perchlorate (PubChem CID 45050736) has the molecular formula C36H31Cl2N2O6P and a molecular weight of 689.53 g/mol. Its IUPAC name is [(E)-1-chloro-3-(3-methylanilino)-2-[(3-methylbenzoyl)amino]-3-oxoprop-1-enyl]-triphenylphosphanium perchlorate.
| Compound Name | [(E)-1-chloro-3-(3-methylanilino)-2-[(3-methylbenzoyl)amino]-3-oxoprop-1-enyl]-triphenylphosphanium perchlorate |
|---|---|
| PubChem CID | 45050736 |
| Molecular Formula | C36H31Cl2N2O6P |
| Molecular Weight | 689.53 g/mol |
| Exact Mass | 688.13 |
| IUPAC Name | [(E)-1-chloro-3-(3-methylanilino)-2-[(3-methylbenzoyl)amino]-3-oxoprop-1-enyl]-triphenylphosphanium perchlorate |
| SMILES | Cc1cccc(NC(=O)/C(NC(=O)c2cccc(C)c2)=C(\Cl)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C36H30ClN2O2P.ClHO4/c1-26-14-12-16-28(24-26)35(40)39-33(36(41)38-29-17-13-15-27(2)25-29)34(37)42(30-18-6-3-7-19-30,31-20-8-4-9-21-31)32-22-10-5-11-23-32;2-1(3,4)5/h3-25H,1-2H3,(H-,38,39,40,41);(H,2,3,4,5)/b34-33-; |
| InChIKey | MCZUHISOWPQJGH-UNJBJSHXSA-N |
| XLogP | 2.32 |
| TPSA | 150.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|