C34H30N2OP+ — CID 6018832
[(E)-1-benzamido-2-(4-methylanilino)ethenyl]-triphenylphosphanium (PubChem CID 6018832) has the molecular formula C34H30N2OP+ and a molecular weight of 513.60 g/mol. Its IUPAC name is [(E)-1-benzamido-2-(4-methylanilino)ethenyl]-triphenylphosphanium.
| Compound Name | [(E)-1-benzamido-2-(4-methylanilino)ethenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 6018832 |
| Molecular Formula | C34H30N2OP+ |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | [(E)-1-benzamido-2-(4-methylanilino)ethenyl]-triphenylphosphanium |
| SMILES | Cc1ccc(N/C=C(\NC(=O)c2ccccc2)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H29N2OP/c1-27-22-24-29(25-23-27)35-26-33(36-34(37)28-14-6-2-7-15-28)38(30-16-8-3-9-17-30,31-18-10-4-11-19-31)32-20-12-5-13-21-32/h2-26,35H,1H3/p+1/b33-26+ |
| InChIKey | VJRKWQHYOTVURB-MHTZHOPKSA-O |
| XLogP | 6.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|