C31H31INOPS — CID 71952486
[1-[(4-methylbenzoyl)amino]-2-propylsulfanylethenyl]-triphenylphosphanium iodide (PubChem CID 71952486) has the molecular formula C31H31INOPS and a molecular weight of 623.54 g/mol. Its IUPAC name is [1-[(4-methylbenzoyl)amino]-2-propylsulfanylethenyl]-triphenylphosphanium iodide.
| Compound Name | [1-[(4-methylbenzoyl)amino]-2-propylsulfanylethenyl]-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 71952486 |
| Molecular Formula | C31H31INOPS |
| Molecular Weight | 623.54 g/mol |
| Exact Mass | 623.09 |
| IUPAC Name | [1-[(4-methylbenzoyl)amino]-2-propylsulfanylethenyl]-triphenylphosphanium iodide |
| SMILES | CCCSC=C(NC(=O)c1ccc(C)cc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
| InChI | InChI=1S/C31H30NOPS.HI/c1-3-23-35-24-30(32-31(33)26-21-19-25(2)20-22-26)34(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29;/h4-22,24H,3,23H2,1-2H3;1H |
| InChIKey | BQESADOSNCCOPO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|