C27H21ClNOPS — CID 135443043
(Z)-2-[(4-chlorobenzoyl)amino]-2-triphenylphosphaniumylethenethiolate (PubChem CID 135443043) has the molecular formula C27H21ClNOPS and a molecular weight of 473.97 g/mol. Its IUPAC name is (Z)-2-[(4-chlorobenzoyl)amino]-2-triphenylphosphaniumylethenethiolate.
| Compound Name | (Z)-2-[(4-chlorobenzoyl)amino]-2-triphenylphosphaniumylethenethiolate |
|---|---|
| PubChem CID | 135443043 |
| Molecular Formula | C27H21ClNOPS |
| Molecular Weight | 473.97 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | (Z)-2-[(4-chlorobenzoyl)amino]-2-triphenylphosphaniumylethenethiolate |
| SMILES | O=C(N/C(=C/[S-])[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H21ClNOPS/c28-22-18-16-21(17-19-22)27(30)29-26(20-32)31(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-20H,(H-,29,30,32)/b26-20- |
| InChIKey | CUKHDFMDSIABME-QOMWVZHYSA-N |
| XLogP | 5.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.97 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|