C33H26Cl3NO5P+ — CID 126958406
[(E)-1-benzamido-2-chloro-2-(4-chlorophenyl)ethenyl]-triphenylphosphanium;perchloric acid (PubChem CID 126958406) has the molecular formula C33H26Cl3NO5P+ and a molecular weight of 653.91 g/mol. Its IUPAC name is [(E)-1-benzamido-2-chloro-2-(4-chlorophenyl)ethenyl]-triphenylphosphanium;perchloric acid.
| Compound Name | [(E)-1-benzamido-2-chloro-2-(4-chlorophenyl)ethenyl]-triphenylphosphanium;perchloric acid |
|---|---|
| PubChem CID | 126958406 |
| Molecular Formula | C33H26Cl3NO5P+ |
| Molecular Weight | 653.91 g/mol |
| Exact Mass | 652.06 |
| IUPAC Name | [(E)-1-benzamido-2-chloro-2-(4-chlorophenyl)ethenyl]-triphenylphosphanium;perchloric acid |
| SMILES | O=C(N/C(=C(\Cl)c1ccc(Cl)cc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C33H24Cl2NOP.ClHO4/c34-27-23-21-25(22-24-27)31(35)33(36-32(37)26-13-5-1-6-14-26)38(28-15-7-2-8-16-28,29-17-9-3-10-18-29)30-19-11-4-12-20-30;2-1(3,4)5/h1-24H;(H,2,3,4,5)/p+1/b33-31+; |
| InChIKey | XLYSHOZXSAXPOH-IFVAIELPSA-O |
| XLogP | 3.51 |
| TPSA | 118.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.91 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|