C27H22Cl2NO5P — CID 71952443
(1-benzamido-2-chloroethenyl)-triphenylphosphanium perchlorate (PubChem CID 71952443) has the molecular formula C27H22Cl2NO5P and a molecular weight of 542.36 g/mol. Its IUPAC name is (1-benzamido-2-chloroethenyl)-triphenylphosphanium perchlorate.
| Compound Name | (1-benzamido-2-chloroethenyl)-triphenylphosphanium perchlorate |
|---|---|
| PubChem CID | 71952443 |
| Molecular Formula | C27H22Cl2NO5P |
| Molecular Weight | 542.36 g/mol |
| Exact Mass | 541.06 |
| IUPAC Name | (1-benzamido-2-chloroethenyl)-triphenylphosphanium perchlorate |
| SMILES | O=C(NC(=CCl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C27H21ClNOP.ClHO4/c28-21-26(29-27(30)22-13-5-1-6-14-22)31(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;2-1(3,4)5/h1-21H;(H,2,3,4,5) |
| InChIKey | CHUNJZCGJINLSO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|