C27H23NOPS+ — CID 6912453
[(Z)-1-benzamido-2-sulfanylethenyl]-triphenylphosphanium (PubChem CID 6912453) has the molecular formula C27H23NOPS+ and a molecular weight of 440.53 g/mol. Its IUPAC name is [(Z)-1-benzamido-2-sulfanylethenyl]-triphenylphosphanium.
| Compound Name | [(Z)-1-benzamido-2-sulfanylethenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 6912453 |
| Molecular Formula | C27H23NOPS+ |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | [(Z)-1-benzamido-2-sulfanylethenyl]-triphenylphosphanium |
| SMILES | O=C(N/C(=C/S)[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22NOPS/c29-27(22-13-5-1-6-14-22)28-26(21-31)30(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-21H,(H-,28,29,31)/p+1/b26-21- |
| InChIKey | DIWINJOYVUPGTM-QLYXXIJNSA-O |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|