C29H25NO3PS+ — CID 4599843
(1-benzamido-3-methoxy-3-oxo-1-sulfanylprop-1-en-2-yl)-triphenylphosphanium (PubChem CID 4599843) has the molecular formula C29H25NO3PS+ and a molecular weight of 498.56 g/mol. Its IUPAC name is (1-benzamido-3-methoxy-3-oxo-1-sulfanylprop-1-en-2-yl)-triphenylphosphanium.
| Compound Name | (1-benzamido-3-methoxy-3-oxo-1-sulfanylprop-1-en-2-yl)-triphenylphosphanium |
|---|---|
| PubChem CID | 4599843 |
| Molecular Formula | C29H25NO3PS+ |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | (1-benzamido-3-methoxy-3-oxo-1-sulfanylprop-1-en-2-yl)-triphenylphosphanium |
| SMILES | COC(=O)C(=C(S)NC(=O)c1ccccc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H24NO3PS/c1-33-29(32)26(28(35)30-27(31)22-14-6-2-7-15-22)34(23-16-8-3-9-17-23,24-18-10-4-11-19-24)25-20-12-5-13-21-25/h2-21H,1H3,(H-,30,31,32,35)/p+1 |
| InChIKey | GNMNOYNCQIUFCE-UHFFFAOYSA-O |
| XLogP | 4.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|