C37H29N3O2PS+ — CID 6056327
[(E)-2-benzamido-3-oxo-1-phenyl-3-(1,3-thiazol-2-ylamino)prop-1-enyl]-triphenylphosphanium (PubChem CID 6056327) has the molecular formula C37H29N3O2PS+ and a molecular weight of 610.70 g/mol. Its IUPAC name is [(E)-2-benzamido-3-oxo-1-phenyl-3-(1,3-thiazol-2-ylamino)prop-1-enyl]-triphenylphosphanium.
| Compound Name | [(E)-2-benzamido-3-oxo-1-phenyl-3-(1,3-thiazol-2-ylamino)prop-1-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 6056327 |
| Molecular Formula | C37H29N3O2PS+ |
| Molecular Weight | 610.70 g/mol |
| Exact Mass | 610.17 |
| IUPAC Name | [(E)-2-benzamido-3-oxo-1-phenyl-3-(1,3-thiazol-2-ylamino)prop-1-enyl]-triphenylphosphanium |
| SMILES | O=C(Nc1nccs1)/C(NC(=O)c1ccccc1)=C(/c1ccccc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H28N3O2PS/c41-35(29-18-8-2-9-19-29)39-33(36(42)40-37-38-26-27-44-37)34(28-16-6-1-7-17-28)43(30-20-10-3-11-21-30,31-22-12-4-13-23-31)32-24-14-5-15-25-32/h1-27H,(H-,38,39,40,41,42)/p+1/b34-33+ |
| InChIKey | LWKFXOQTYOHOGX-JEIPZWNWSA-O |
| XLogP | 6.87 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.70 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|