C17H23N — CID 145266659
N-[(3E,5Z)-2,7-dimethylnona-1,3,5-trien-4-yl]aniline (PubChem CID 145266659) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is N-[(3E,5Z)-2,7-dimethylnona-1,3,5-trien-4-yl]aniline.
| Compound Name | N-[(3E,5Z)-2,7-dimethylnona-1,3,5-trien-4-yl]aniline |
|---|---|
| PubChem CID | 145266659 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-[(3E,5Z)-2,7-dimethylnona-1,3,5-trien-4-yl]aniline |
| SMILES | C=C(C)/C=C(\C=C/C(C)CC)Nc1ccccc1 |
| InChI | InChI=1S/C17H23N/c1-5-15(4)11-12-17(13-14(2)3)18-16-9-7-6-8-10-16/h6-13,15,18H,2,5H2,1,3-4H3/b12-11-,17-13+ |
| InChIKey | QZBJZZSIVQMWDM-WCVKEAJASA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|