C20H23N — CID 145025138
4-methyl-N-[(2E,4Z)-6-phenylhepta-2,4-dien-3-yl]aniline (PubChem CID 145025138) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 4-methyl-N-[(2E,4Z)-6-phenylhepta-2,4-dien-3-yl]aniline.
| Compound Name | 4-methyl-N-[(2E,4Z)-6-phenylhepta-2,4-dien-3-yl]aniline |
|---|---|
| PubChem CID | 145025138 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 4-methyl-N-[(2E,4Z)-6-phenylhepta-2,4-dien-3-yl]aniline |
| SMILES | C/C=C(\C=C/C(C)c1ccccc1)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H23N/c1-4-19(21-20-13-10-16(2)11-14-20)15-12-17(3)18-8-6-5-7-9-18/h4-15,17,21H,1-3H3/b15-12-,19-4+ |
| InChIKey | PTIVCQKDNYMCKR-UCDHIWJNSA-N |
| XLogP | 5.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|