C40H38N2O — CID 154692062
N-[4-[(3Z,5E)-5-anilinoocta-3,5,7-trien-2-yl]phenyl]-4-(4-methylphenoxy)-N-phenylcyclohepta-1,3,5-trien-1-amine (PubChem CID 154692062) has the molecular formula C40H38N2O and a molecular weight of 562.76 g/mol. Its IUPAC name is N-[4-[(3Z,5E)-5-anilinoocta-3,5,7-trien-2-yl]phenyl]-4-(4-methylphenoxy)-N-phenylcyclohepta-1,3,5-trien-1-amine.
| Compound Name | N-[4-[(3Z,5E)-5-anilinoocta-3,5,7-trien-2-yl]phenyl]-4-(4-methylphenoxy)-N-phenylcyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 154692062 |
| Molecular Formula | C40H38N2O |
| Molecular Weight | 562.76 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | N-[4-[(3Z,5E)-5-anilinoocta-3,5,7-trien-2-yl]phenyl]-4-(4-methylphenoxy)-N-phenylcyclohepta-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/C(C)c1ccc(N(C2=CC=C(Oc3ccc(C)cc3)C=CC2)c2ccccc2)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C40H38N2O/c1-4-12-34(41-35-13-7-5-8-14-35)24-21-32(3)33-22-25-38(26-23-33)42(36-15-9-6-10-16-36)37-17-11-18-39(30-27-37)43-40-28-19-31(2)20-29-40/h4-16,18-30,32,41H,1,17H2,2-3H3/b24-21-,34-12+ |
| InChIKey | LEHVBYFTCIVHCH-MHGVJYEBSA-N |
| XLogP | 10.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.76 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|