C48H42N2O3 — CID 134388144
[4-[4-(N-[(1E,4E,7Z)-5-(N-(4-methoxyphenyl)anilino)cycloocta-1,4,7-trien-1-yl]anilino)cyclohepta-1,3,6-trien-1-yl]oxyphenyl]-(4-methylphenyl)methanone (PubChem CID 134388144) has the molecular formula C48H42N2O3 and a molecular weight of 694.88 g/mol. Its IUPAC name is [4-[4-(N-[(1E,4E,7Z)-5-(N-(4-methoxyphenyl)anilino)cycloocta-1,4,7-trien-1-yl]anilino)cyclohepta-1,3,6-trien-1-yl]oxyphenyl]-(4-methylphenyl)methanone.
| Compound Name | [4-[4-(N-[(1E,4E,7Z)-5-(N-(4-methoxyphenyl)anilino)cycloocta-1,4,7-trien-1-yl]anilino)cyclohepta-1,3,6-trien-1-yl]oxyphenyl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 134388144 |
| Molecular Formula | C48H42N2O3 |
| Molecular Weight | 694.88 g/mol |
| Exact Mass | 694.32 |
| IUPAC Name | [4-[4-(N-[(1E,4E,7Z)-5-(N-(4-methoxyphenyl)anilino)cycloocta-1,4,7-trien-1-yl]anilino)cyclohepta-1,3,6-trien-1-yl]oxyphenyl]-(4-methylphenyl)methanone |
| SMILES | COc1ccc(N(/C2=C/C/C=C(N(C3=CC=C(Oc4ccc(C(=O)c5ccc(C)cc5)cc4)C=CC3)c3ccccc3)\C=C/C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C48H42N2O3/c1-36-22-24-37(25-23-36)48(51)38-26-31-47(32-27-38)53-46-21-11-20-43(30-35-46)49(39-12-5-3-6-13-39)41-16-9-18-42(19-10-17-41)50(40-14-7-4-8-15-40)44-28-33-45(52-2)34-29-44/h3-9,11-17,19,21-35H,10,18,20H2,1-2H3/b16-9-,41-17+,42-19+ |
| InChIKey | AIIGSERFKDLMQM-FGHUFBPZSA-N |
| XLogP | 11.80 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.88 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |