C60H50N2O3 — CID 143103720
[4-[4-[N-[4-(N-(4-methoxyphenyl)anilino)phenyl]-4-[(Z)-2-phenylethenyl]anilino]phenoxy]phenyl]-(4-methylphenyl)methanone;toluene (PubChem CID 143103720) has the molecular formula C60H50N2O3 and a molecular weight of 847.07 g/mol. Its IUPAC name is [4-[4-[N-[4-(N-(4-methoxyphenyl)anilino)phenyl]-4-[(Z)-2-phenylethenyl]anilino]phenoxy]phenyl]-(4-methylphenyl)methanone;toluene.
| Compound Name | [4-[4-[N-[4-(N-(4-methoxyphenyl)anilino)phenyl]-4-[(Z)-2-phenylethenyl]anilino]phenoxy]phenyl]-(4-methylphenyl)methanone;toluene |
|---|---|
| PubChem CID | 143103720 |
| Molecular Formula | C60H50N2O3 |
| Molecular Weight | 847.07 g/mol |
| Exact Mass | 846.38 |
| IUPAC Name | [4-[4-[N-[4-(N-(4-methoxyphenyl)anilino)phenyl]-4-[(Z)-2-phenylethenyl]anilino]phenoxy]phenyl]-(4-methylphenyl)methanone;toluene |
| SMILES | COc1ccc(N(c2ccccc2)c2ccc(N(c3ccc(/C=C\c4ccccc4)cc3)c3ccc(Oc4ccc(C(=O)c5ccc(C)cc5)cc4)cc3)cc2)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C53H42N2O3.C7H8/c1-39-13-19-42(20-14-39)53(56)43-21-33-51(34-22-43)58-52-37-31-49(32-38-52)55(45-23-17-41(18-24-45)16-15-40-9-5-3-6-10-40)47-27-25-46(26-28-47)54(44-11-7-4-8-12-44)48-29-35-50(57-2)36-30-48;1-7-5-3-2-4-6-7/h3-38H,1-2H3;2-6H,1H3/b16-15-; |
| InChIKey | LBKRULSPNQSDAR-YFKNTREVSA-N |
| XLogP | 16.13 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.07 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|