C36H32N6O — CID 59685810
2-N-(4-methoxyphenyl)-6-N-methyl-4-N-(4-methylphenyl)-2-N,4-N,6-N-triphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 59685810) has the molecular formula C36H32N6O and a molecular weight of 564.69 g/mol. Its IUPAC name is 2-N-(4-methoxyphenyl)-6-N-methyl-4-N-(4-methylphenyl)-2-N,4-N,6-N-triphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(4-methoxyphenyl)-6-N-methyl-4-N-(4-methylphenyl)-2-N,4-N,6-N-triphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 59685810 |
| Molecular Formula | C36H32N6O |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 2-N-(4-methoxyphenyl)-6-N-methyl-4-N-(4-methylphenyl)-2-N,4-N,6-N-triphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(N(c2ccccc2)c2nc(N(C)c3ccccc3)nc(N(c3ccccc3)c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C36H32N6O/c1-27-19-21-31(22-20-27)41(29-15-9-5-10-16-29)35-37-34(40(2)28-13-7-4-8-14-28)38-36(39-35)42(30-17-11-6-12-18-30)32-23-25-33(43-3)26-24-32/h4-26H,1-3H3 |
| InChIKey | NCQQXEDQFWEOPQ-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 57.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |