C57H50N6O2 — CID 59533037
4,6-bis[4-(4-methyl-N-(4-methylphenyl)anilino)phenoxy]-N,N-bis(4-methylphenyl)-1,3,5-triazin-2-amine (PubChem CID 59533037) has the molecular formula C57H50N6O2 and a molecular weight of 851.07 g/mol. Its IUPAC name is 4,6-bis[4-(4-methyl-N-(4-methylphenyl)anilino)phenoxy]-N,N-bis(4-methylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis[4-(4-methyl-N-(4-methylphenyl)anilino)phenoxy]-N,N-bis(4-methylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 59533037 |
| Molecular Formula | C57H50N6O2 |
| Molecular Weight | 851.07 g/mol |
| Exact Mass | 850.40 |
| IUPAC Name | 4,6-bis[4-(4-methyl-N-(4-methylphenyl)anilino)phenoxy]-N,N-bis(4-methylphenyl)-1,3,5-triazin-2-amine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(Oc3nc(Oc4ccc(N(c5ccc(C)cc5)c5ccc(C)cc5)cc4)nc(N(c4ccc(C)cc4)c4ccc(C)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C57H50N6O2/c1-39-7-19-45(20-8-39)61(46-21-9-40(2)10-22-46)49-31-35-53(36-32-49)64-56-58-55(63(51-27-15-43(5)16-28-51)52-29-17-44(6)18-30-52)59-57(60-56)65-54-37-33-50(34-38-54)62(47-23-11-41(3)12-24-47)48-25-13-42(4)14-26-48/h7-38H,1-6H3 |
| InChIKey | LFFSMUNEKLGNTF-UHFFFAOYSA-N |
| XLogP | 15.72 |
| TPSA | 66.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.07 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |