C46H36N6O6 — CID 169281032
2-[4-[4-[[4,6-bis(4-methylphenoxy)-1,3,5-triazin-2-yl]oxy]phenyl]phenoxy]-4,6-bis(4-methylphenoxy)-1,3,5-triazine (PubChem CID 169281032) has the molecular formula C46H36N6O6 and a molecular weight of 768.83 g/mol. Its IUPAC name is 2-[4-[4-[[4,6-bis(4-methylphenoxy)-1,3,5-triazin-2-yl]oxy]phenyl]phenoxy]-4,6-bis(4-methylphenoxy)-1,3,5-triazine.
| Compound Name | 2-[4-[4-[[4,6-bis(4-methylphenoxy)-1,3,5-triazin-2-yl]oxy]phenyl]phenoxy]-4,6-bis(4-methylphenoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 169281032 |
| Molecular Formula | C46H36N6O6 |
| Molecular Weight | 768.83 g/mol |
| Exact Mass | 768.27 |
| IUPAC Name | 2-[4-[4-[[4,6-bis(4-methylphenoxy)-1,3,5-triazin-2-yl]oxy]phenyl]phenoxy]-4,6-bis(4-methylphenoxy)-1,3,5-triazine |
| SMILES | Cc1ccc(Oc2nc(Oc3ccc(C)cc3)nc(Oc3ccc(-c4ccc(Oc5nc(Oc6ccc(C)cc6)nc(Oc6ccc(C)cc6)n5)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C46H36N6O6/c1-29-5-17-35(18-6-29)53-41-47-42(54-36-19-7-30(2)8-20-36)50-45(49-41)57-39-25-13-33(14-26-39)34-15-27-40(28-16-34)58-46-51-43(55-37-21-9-31(3)10-22-37)48-44(52-46)56-38-23-11-32(4)12-24-38/h5-28H,1-4H3 |
| InChIKey | KEZWDWSQWPMWNO-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 132.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.83 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |