C55H48N2 — CID 143983833
benzene;4-[(E)-2-[4-[4-[(E)-2-[4-(N-methylanilino)phenyl]ethenyl]phenyl]cyclohepta-1,3,6-trien-1-yl]ethenyl]-N,N-diphenylcyclohepta-1,3,5-trien-1-amine (PubChem CID 143983833) has the molecular formula C55H48N2 and a molecular weight of 737.00 g/mol. Its IUPAC name is benzene;4-[(E)-2-[4-[4-[(E)-2-[4-(N-methylanilino)phenyl]ethenyl]phenyl]cyclohepta-1,3,6-trien-1-yl]ethenyl]-N,N-diphenylcyclohepta-1,3,5-trien-1-amine.
| Compound Name | benzene;4-[(E)-2-[4-[4-[(E)-2-[4-(N-methylanilino)phenyl]ethenyl]phenyl]cyclohepta-1,3,6-trien-1-yl]ethenyl]-N,N-diphenylcyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 143983833 |
| Molecular Formula | C55H48N2 |
| Molecular Weight | 737.00 g/mol |
| Exact Mass | 736.38 |
| IUPAC Name | benzene;4-[(E)-2-[4-[4-[(E)-2-[4-(N-methylanilino)phenyl]ethenyl]phenyl]cyclohepta-1,3,6-trien-1-yl]ethenyl]-N,N-diphenylcyclohepta-1,3,5-trien-1-amine |
| SMILES | CN(c1ccccc1)c1ccc(/C=C/c2ccc(C3=CC=C(/C=C/C4=CC=C(N(c5ccccc5)c5ccccc5)CC=C4)C=CC3)cc2)cc1.c1ccccc1 |
| InChI | InChI=1S/C49H42N2.C6H6/c1-50(45-16-5-2-6-17-45)46-36-30-42(31-37-46)26-25-41-28-34-44(35-29-41)43-15-11-13-39(27-33-43)23-24-40-14-12-22-49(38-32-40)51(47-18-7-3-8-19-47)48-20-9-4-10-21-48;1-2-4-6-5-3-1/h2-14,16-21,23-38H,15,22H2,1H3;1-6H/b24-23+,26-25+; |
| InChIKey | YJUATSSRXAFBEL-HMNSNYPBSA-N |
| XLogP | 14.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.00 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|