C31H25NO — CID 88863583
4-(4-phenyl-N-(4-phenylcyclohexa-1,3-dien-1-yl)anilino)benzaldehyde (PubChem CID 88863583) has the molecular formula C31H25NO and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-(4-phenyl-N-(4-phenylcyclohexa-1,3-dien-1-yl)anilino)benzaldehyde.
| Compound Name | 4-(4-phenyl-N-(4-phenylcyclohexa-1,3-dien-1-yl)anilino)benzaldehyde |
|---|---|
| PubChem CID | 88863583 |
| Molecular Formula | C31H25NO |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 4-(4-phenyl-N-(4-phenylcyclohexa-1,3-dien-1-yl)anilino)benzaldehyde |
| SMILES | O=Cc1ccc(N(C2=CC=C(c3ccccc3)CC2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H25NO/c33-23-24-11-17-29(18-12-24)32(30-19-13-27(14-20-30)25-7-3-1-4-8-25)31-21-15-28(16-22-31)26-9-5-2-6-10-26/h1-15,17-21,23H,16,22H2 |
| InChIKey | OURZSIOGMVPNFZ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|