C56H54N4 — CID 138666209
4-N-[4-(N-cyclohexa-1,5-dien-1-ylanilino)phenyl]-4-N-[4-(N-[(Z)-3-methylhex-4-en-2-yl]anilino)phenyl]-1-N,1-N-diphenylcyclohepta-1,3,5-triene-1,4-diamine (PubChem CID 138666209) has the molecular formula C56H54N4 and a molecular weight of 783.08 g/mol. Its IUPAC name is 4-N-[4-(N-cyclohexa-1,5-dien-1-ylanilino)phenyl]-4-N-[4-(N-[(Z)-3-methylhex-4-en-2-yl]anilino)phenyl]-1-N,1-N-diphenylcyclohepta-1,3,5-triene-1,4-diamine.
| Compound Name | 4-N-[4-(N-cyclohexa-1,5-dien-1-ylanilino)phenyl]-4-N-[4-(N-[(Z)-3-methylhex-4-en-2-yl]anilino)phenyl]-1-N,1-N-diphenylcyclohepta-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 138666209 |
| Molecular Formula | C56H54N4 |
| Molecular Weight | 783.08 g/mol |
| Exact Mass | 782.43 |
| IUPAC Name | 4-N-[4-(N-cyclohexa-1,5-dien-1-ylanilino)phenyl]-4-N-[4-(N-[(Z)-3-methylhex-4-en-2-yl]anilino)phenyl]-1-N,1-N-diphenylcyclohepta-1,3,5-triene-1,4-diamine |
| SMILES | C/C=C\C(C)C(C)N(c1ccccc1)c1ccc(N(C2=CC=C(N(c3ccccc3)c3ccccc3)CC=C2)c2ccc(N(C3=CCCC=C3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C56H54N4/c1-4-21-44(2)45(3)57(46-22-10-5-11-23-46)53-36-38-55(39-37-53)60(56-42-40-54(41-43-56)59(49-28-16-8-17-29-49)50-30-18-9-19-31-50)52-33-20-32-51(34-35-52)58(47-24-12-6-13-25-47)48-26-14-7-15-27-48/h4-8,10-18,20-31,33-45H,9,19,32H2,1-3H3/b21-4- |
| InChIKey | YJQDYGSNBKXQNA-IGLQUIOVSA-N |
| XLogP | 15.50 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.08 |
| LogP ≤ 5 | 15.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|