C60H52N4 — CID 71017943
1-N-cyclohexa-1,5-dien-1-yl-1-N,4-N-diphenyl-4-N-[4-[4-(N-[4-(N-phenylanilino)phenyl]anilino)cyclohexa-2,4-dien-1-yl]cyclohexa-1,5-dien-1-yl]benzene-1,4-diamine (PubChem CID 71017943) has the molecular formula C60H52N4 and a molecular weight of 829.10 g/mol. Its IUPAC name is 1-N-cyclohexa-1,5-dien-1-yl-1-N,4-N-diphenyl-4-N-[4-[4-(N-[4-(N-phenylanilino)phenyl]anilino)cyclohexa-2,4-dien-1-yl]cyclohexa-1,5-dien-1-yl]benzene-1,4-diamine.
| Compound Name | 1-N-cyclohexa-1,5-dien-1-yl-1-N,4-N-diphenyl-4-N-[4-[4-(N-[4-(N-phenylanilino)phenyl]anilino)cyclohexa-2,4-dien-1-yl]cyclohexa-1,5-dien-1-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 71017943 |
| Molecular Formula | C60H52N4 |
| Molecular Weight | 829.10 g/mol |
| Exact Mass | 828.42 |
| IUPAC Name | 1-N-cyclohexa-1,5-dien-1-yl-1-N,4-N-diphenyl-4-N-[4-[4-(N-[4-(N-phenylanilino)phenyl]anilino)cyclohexa-2,4-dien-1-yl]cyclohexa-1,5-dien-1-yl]benzene-1,4-diamine |
| SMILES | C1=CC(N(c2ccccc2)c2ccc(N(C3=CCC(C4C=CC(N(c5ccccc5)c5ccc(N(c6ccccc6)c6ccccc6)cc5)=CC4)C=C3)c3ccccc3)cc2)=CCC1 |
| InChI | InChI=1S/C60H52N4/c1-7-19-49(20-8-1)61(50-21-9-2-10-22-50)57-39-43-59(44-40-57)63(53-27-15-5-16-28-53)55-35-31-47(32-36-55)48-33-37-56(38-34-48)64(54-29-17-6-18-30-54)60-45-41-58(42-46-60)62(51-23-11-3-12-24-51)52-25-13-4-14-26-52/h1-3,5-13,15-31,33,35-48H,4,14,32,34H2 |
| InChIKey | UIOGREYIMHTASC-UHFFFAOYSA-N |
| XLogP | 16.42 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.10 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |