C26H34BNO2 — CID 145177184
N-cyclohexa-1,5-dien-1-yl-N-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;ethane (PubChem CID 145177184) has the molecular formula C26H34BNO2 and a molecular weight of 403.38 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-N-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;ethane.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-N-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;ethane |
|---|---|
| PubChem CID | 145177184 |
| Molecular Formula | C26H34BNO2 |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-N-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;ethane |
| SMILES | CC.CC1(C)OB(c2ccc(N(C3=CCCC=C3)c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C24H28BNO2.C2H6/c1-23(2)24(3,4)28-25(27-23)19-15-17-22(18-16-19)26(20-11-7-5-8-12-20)21-13-9-6-10-14-21;1-2/h5,7-9,11-18H,6,10H2,1-4H3;1-2H3 |
| InChIKey | XAPUKUYMCQYOKA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|