C24H32BNO2 — CID 143516798
N-cyclohexyl-N-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 143516798) has the molecular formula C24H32BNO2 and a molecular weight of 377.34 g/mol. Its IUPAC name is N-cyclohexyl-N-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N-cyclohexyl-N-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 143516798 |
| Molecular Formula | C24H32BNO2 |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N-cyclohexyl-N-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC1(C)OB(c2ccc(N(c3ccccc3)C3CCCCC3)cc2)OC1(C)C |
| InChI | InChI=1S/C24H32BNO2/c1-23(2)24(3,4)28-25(27-23)19-15-17-22(18-16-19)26(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5,7-8,11-12,15-18,21H,6,9-10,13-14H2,1-4H3 |
| InChIKey | BIBUHLNPDCILDS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|