C20H30BNO3 — CID 165050500
1-cyclohexyl-N-methoxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine (PubChem CID 165050500) has the molecular formula C20H30BNO3 and a molecular weight of 343.28 g/mol. Its IUPAC name is 1-cyclohexyl-N-methoxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine.
| Compound Name | 1-cyclohexyl-N-methoxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 165050500 |
| Molecular Formula | C20H30BNO3 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-cyclohexyl-N-methoxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
| SMILES | CON=C(c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H30BNO3/c1-19(2)20(3,4)25-21(24-19)17-13-11-16(12-14-17)18(22-23-5)15-9-7-6-8-10-15/h11-15H,6-10H2,1-5H3 |
| InChIKey | POVUKSYYMGZRGB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|