C21H35BClNO2 — CID 157010483
N-(cyclohexylmethyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine;hydrochloride (PubChem CID 157010483) has the molecular formula C21H35BClNO2 and a molecular weight of 379.78 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine;hydrochloride.
| Compound Name | N-(cyclohexylmethyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 157010483 |
| Molecular Formula | C21H35BClNO2 |
| Molecular Weight | 379.78 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine;hydrochloride |
| SMILES | CC1(C)OB(c2ccc(CCNCC3CCCCC3)cc2)OC1(C)C.Cl |
| InChI | InChI=1S/C21H34BNO2.ClH/c1-20(2)21(3,4)25-22(24-20)19-12-10-17(11-13-19)14-15-23-16-18-8-6-5-7-9-18;/h10-13,18,23H,5-9,14-16H2,1-4H3;1H |
| InChIKey | JTHGGWPEHAVDCJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.78 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|