C18H30BN3O2S — CID 177227935
(Z)-2-[amino(cyclobutyl)amino]ethenamine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenethiol (PubChem CID 177227935) has the molecular formula C18H30BN3O2S and a molecular weight of 363.34 g/mol. Its IUPAC name is (Z)-2-[amino(cyclobutyl)amino]ethenamine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenethiol.
| Compound Name | (Z)-2-[amino(cyclobutyl)amino]ethenamine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenethiol |
|---|---|
| PubChem CID | 177227935 |
| Molecular Formula | C18H30BN3O2S |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (Z)-2-[amino(cyclobutyl)amino]ethenamine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenethiol |
| SMILES | CC1(C)OB(c2ccc(S)cc2)OC1(C)C.N/C=C\N(N)C1CCC1 |
| InChI | InChI=1S/C12H17BO2S.C6H13N3/c1-11(2)12(3,4)15-13(14-11)9-5-7-10(16)8-6-9;7-4-5-9(8)6-2-1-3-6/h5-8,16H,1-4H3;4-6H,1-3,7-8H2/b;5-4- |
| InChIKey | AQPCGWAAECDLGX-GUHKXDMSSA-N |
| XLogP | 2.42 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|