C28H33BN2O2 — CID 132609991
N-phenyl-N-[4-(propyliminomethyl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 132609991) has the molecular formula C28H33BN2O2 and a molecular weight of 440.40 g/mol. Its IUPAC name is N-phenyl-N-[4-(propyliminomethyl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N-phenyl-N-[4-(propyliminomethyl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 132609991 |
| Molecular Formula | C28H33BN2O2 |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | N-phenyl-N-[4-(propyliminomethyl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CCC/N=C/c1ccc(N(c2ccccc2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C28H33BN2O2/c1-6-20-30-21-22-12-16-25(17-13-22)31(24-10-8-7-9-11-24)26-18-14-23(15-19-26)29-32-27(2,3)28(4,5)33-29/h7-19,21H,6,20H2,1-5H3/b30-21+ |
| InChIKey | YBWGBJAKPAICQF-MWAVMZGNSA-N |
| XLogP | 6.28 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|