C36H40BNO2 — CID 154586874
N,N-diphenyl-4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexyl]aniline (PubChem CID 154586874) has the molecular formula C36H40BNO2 and a molecular weight of 529.53 g/mol. Its IUPAC name is N,N-diphenyl-4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexyl]aniline.
| Compound Name | N,N-diphenyl-4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexyl]aniline |
|---|---|
| PubChem CID | 154586874 |
| Molecular Formula | C36H40BNO2 |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | N,N-diphenyl-4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexyl]aniline |
| SMILES | CC1(C)OB(c2ccc(C3(c4ccc(N(c5ccccc5)c5ccccc5)cc4)CCCCC3)cc2)OC1(C)C |
| InChI | InChI=1S/C36H40BNO2/c1-34(2)35(3,4)40-37(39-34)30-22-18-28(19-23-30)36(26-12-7-13-27-36)29-20-24-33(25-21-29)38(31-14-8-5-9-15-31)32-16-10-6-11-17-32/h5-6,8-11,14-25H,7,12-13,26-27H2,1-4H3 |
| InChIKey | OZBYEPUMXDFKMP-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|