C36H34BNO3 — CID 142408522
N-cyclohexa-1,5-dien-1-yl-N-(4-dibenzofuran-1-ylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 142408522) has the molecular formula C36H34BNO3 and a molecular weight of 539.48 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-N-(4-dibenzofuran-1-ylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-N-(4-dibenzofuran-1-ylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 142408522 |
| Molecular Formula | C36H34BNO3 |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-N-(4-dibenzofuran-1-ylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC1(C)OB(c2ccc(N(C3=CCCC=C3)c3ccc(-c4cccc5oc6ccccc6c45)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C36H34BNO3/c1-35(2)36(3,4)41-37(40-35)26-19-23-29(24-20-26)38(27-11-6-5-7-12-27)28-21-17-25(18-22-28)30-14-10-16-33-34(30)31-13-8-9-15-32(31)39-33/h6,8-24H,5,7H2,1-4H3 |
| InChIKey | QCPVNNQRTGHGGL-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|