C34H29BO3 — CID 171731224
4,4,5,5-tetramethyl-2-[2,3,4,6-tetradeuterio-5-(1,3,4,5,7,8-hexadeuterio-6-dibenzofuran-1-ylnaphthalen-2-yl)phenyl]-1,3,2-dioxaborolane (PubChem CID 171731224) has the molecular formula C34H29BO3 and a molecular weight of 506.48 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[2,3,4,6-tetradeuterio-5-(1,3,4,5,7,8-hexadeuterio-6-dibenzofuran-1-ylnaphthalen-2-yl)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[2,3,4,6-tetradeuterio-5-(1,3,4,5,7,8-hexadeuterio-6-dibenzofuran-1-ylnaphthalen-2-yl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171731224 |
| Molecular Formula | C34H29BO3 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[2,3,4,6-tetradeuterio-5-(1,3,4,5,7,8-hexadeuterio-6-dibenzofuran-1-ylnaphthalen-2-yl)phenyl]-1,3,2-dioxaborolane |
| SMILES | [2H]c1c([2H])c(B2OC(C)(C)C(C)(C)O2)c([2H])c(-c2c([2H])c([2H])c3c([2H])c(-c4cccc5oc6ccccc6c45)c([2H])c([2H])c3c2[2H])c1[2H] |
| InChI | InChI=1S/C34H29BO3/c1-33(2)34(3,4)38-35(37-33)27-10-7-9-22(21-27)23-15-16-25-20-26(18-17-24(25)19-23)28-12-8-14-31-32(28)29-11-5-6-13-30(29)36-31/h5-21H,1-4H3/i7D,9D,10D,15D,16D,17D,18D,19D,20D,21D |
| InChIKey | BENCOIJJJNWKJK-JYCGRMTFSA-N |
| XLogP | 8.37 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|