C32H29BO2 — CID 165090359
4,4,5,5-tetramethyl-2-[2,3,4,6-tetradeuterio-5-(6-naphthalen-2-ylnaphthalen-2-yl)phenyl]-1,3,2-dioxaborolane (PubChem CID 165090359) has the molecular formula C32H29BO2 and a molecular weight of 460.42 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[2,3,4,6-tetradeuterio-5-(6-naphthalen-2-ylnaphthalen-2-yl)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[2,3,4,6-tetradeuterio-5-(6-naphthalen-2-ylnaphthalen-2-yl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 165090359 |
| Molecular Formula | C32H29BO2 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[2,3,4,6-tetradeuterio-5-(6-naphthalen-2-ylnaphthalen-2-yl)phenyl]-1,3,2-dioxaborolane |
| SMILES | [2H]c1c([2H])c(B2OC(C)(C)C(C)(C)O2)c([2H])c(-c2ccc3cc(-c4ccc5ccccc5c4)ccc3c2)c1[2H] |
| InChI | InChI=1S/C32H29BO2/c1-31(2)32(3,4)35-33(34-31)30-11-7-10-24(21-30)25-14-15-29-20-28(17-16-27(29)19-25)26-13-12-22-8-5-6-9-23(22)18-26/h5-21H,1-4H3/i7D,10D,11D,21D |
| InChIKey | KXMPHVWXHYZGED-FQHVDXETSA-N |
| XLogP | 7.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|