C42H35BO2 — CID 170691108
2-[3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-5-(6-naphthalen-2-ylnaphthalen-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 170691108) has the molecular formula C42H35BO2 and a molecular weight of 589.59 g/mol. Its IUPAC name is 2-[3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-5-(6-naphthalen-2-ylnaphthalen-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-5-(6-naphthalen-2-ylnaphthalen-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 170691108 |
| Molecular Formula | C42H35BO2 |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 589.32 |
| IUPAC Name | 2-[3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-5-(6-naphthalen-2-ylnaphthalen-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cc(B4OC(C)(C)C(C)(C)O4)cc(-c4ccc5cc(-c6ccc7ccccc7c6)ccc5c4)c3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C42H35BO2/c1-41(2)42(3,4)45-43(44-41)38-26-36(25-37(27-38)40-15-9-13-29-11-7-8-14-39(29)40)35-21-20-33-23-32(18-19-34(33)24-35)31-17-16-28-10-5-6-12-30(28)22-31/h5-27H,1-4H3/i7D,8D,9D,11D,13D,14D,15D |
| InChIKey | CFVHHEPCWOSDFE-YAQMJQLQSA-N |
| XLogP | 10.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|