C24H17N3 — CID 168805950
2-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-4-methyl-6-naphthalen-2-yl-1,3,5-triazine (PubChem CID 168805950) has the molecular formula C24H17N3 and a molecular weight of 354.46 g/mol. Its IUPAC name is 2-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-4-methyl-6-naphthalen-2-yl-1,3,5-triazine.
| Compound Name | 2-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-4-methyl-6-naphthalen-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 168805950 |
| Molecular Formula | C24H17N3 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-4-methyl-6-naphthalen-2-yl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3nc(C)nc(-c4ccc5ccccc5c4)n3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C24H17N3/c1-16-25-23(20-14-13-17-7-2-3-9-19(17)15-20)27-24(26-16)22-12-6-10-18-8-4-5-11-21(18)22/h2-15H,1H3/i4D,5D,6D,8D,10D,11D,12D |
| InChIKey | YVJSRXKIEKNFQZ-CTWGMNOPSA-N |
| XLogP | 5.82 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |