C47H29N3O — CID 169053834
2-dibenzofuran-1-yl-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-[3-(4-naphthalen-2-ylphenyl)phenyl]-1,3,5-triazine (PubChem CID 169053834) has the molecular formula C47H29N3O and a molecular weight of 658.81 g/mol. Its IUPAC name is 2-dibenzofuran-1-yl-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-[3-(4-naphthalen-2-ylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-1-yl-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-[3-(4-naphthalen-2-ylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 169053834 |
| Molecular Formula | C47H29N3O |
| Molecular Weight | 658.81 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | 2-dibenzofuran-1-yl-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-[3-(4-naphthalen-2-ylphenyl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3nc(-c4cccc(-c5ccc(-c6ccc7ccccc7c6)cc5)c4)nc(-c4cccc5oc6ccccc6c45)n3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C47H29N3O/c1-2-12-34-28-36(27-26-30(34)10-1)32-24-22-31(23-25-32)35-14-7-15-37(29-35)45-48-46(39-18-8-13-33-11-3-4-16-38(33)39)50-47(49-45)41-19-9-21-43-44(41)40-17-5-6-20-42(40)51-43/h1-29H/i3D,4D,8D,11D,13D,16D,18D |
| InChIKey | ROPXHFODZNGICK-JQYYNACBSA-N |
| XLogP | 12.41 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.81 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |