C49H29N3O2 — CID 169053841
2-dibenzofuran-1-yl-4-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-6-[3-(4-naphthalen-2-ylphenyl)phenyl]-1,3,5-triazine (PubChem CID 169053841) has the molecular formula C49H29N3O2 and a molecular weight of 698.83 g/mol. Its IUPAC name is 2-dibenzofuran-1-yl-4-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-6-[3-(4-naphthalen-2-ylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-1-yl-4-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-6-[3-(4-naphthalen-2-ylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 169053841 |
| Molecular Formula | C49H29N3O2 |
| Molecular Weight | 698.83 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | 2-dibenzofuran-1-yl-4-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-6-[3-(4-naphthalen-2-ylphenyl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c([2H])c([2H])c(-c4nc(-c5cccc(-c6ccc(-c7ccc8ccccc8c7)cc6)c5)nc(-c5cccc6oc7ccccc7c56)n4)c32)c1[2H] |
| InChI | InChI=1S/C49H29N3O2/c1-2-11-33-28-35(27-26-30(33)10-1)32-24-22-31(23-25-32)34-12-7-13-36(29-34)47-50-48(39-16-8-20-43-45(39)37-14-3-5-18-41(37)53-43)52-49(51-47)40-17-9-21-44-46(40)38-15-4-6-19-42(38)54-44/h1-29H/i3D,5D,8D,14D,16D,18D,20D |
| InChIKey | ZSQXNDZMFDKZCV-AYZLVHJGSA-N |
| XLogP | 13.16 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.83 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |